symbolic-regression/Code/symbolic_regress_mdl3.f
Silviu Marian Udrescu d7b3d8560b
Add files via upload
2020-05-10 20:22:43 -04:00

244 lines
8.9 KiB
Fortran

! Max Tegmark 171119, 190128-31, 190506, 200427-29
! Loads templates.csv functions.dat and mystery.dat, returns winners.
! Rejects Pareto-dominated formulas not based on hard sup-norm cut, but using a
! hypothesis-testing framework with a z-score z_n = sqrt(n)*(<b_n>-<b_best>)/sigma_best
! scp -P2222 symbolic_regress.f euler@tor.mit.edu:FEYNMAN
! COMPILATION: a f 'f77 -O3 -o symbolic_regress_mdl3.x symbolic_regress_mdl3.f |& more'
! SAMPLE USAGE: call symbolic_regress_mdl3.x 7ops.txt arity2templates.txt mystery2.dat results.dat 10 0
! call symbolic_regress_mdl3.x 6ops.txt arity2templates.txt mysteryB3.dat results.dat 10 0 (takes a few minutes)
! call symbolic_regress_mdl3.x 14ops.txt arity2templates.txt mystery.dat results.dat 10 0
! call symbolic_regress_mdl3.x 14ops.txt arity2templates.txt mystery.dat results.dat 1000 0 (if skips over correct formula)
! functions.dat contains a single line (say "0>+*-/") with the single-character symbols
! that will be used, drawn from this list:
!
! Binary:
! +: add
! *: multiply
! -: subtract
! /: divide (Put "D" instead of "/" in file, since f77 can't load backslash
!
! Unary:
! >: increment (x -> x+1)
! <: decrement (x -> x-1)
! ~: negate (x-> -x)
! \: invert (x->1/x) (Put "I" instead of "\" in file, since f77 can't load backslash
! L: logaritm: (x-> ln(x)
! E: exponentiate (x->exp(x))
! S: sin: (x->sin(x))
! C: cos: (x->cos(x))
! A: abs: (x->abs(x))
! N: arcsin: (x->arcsin(x))
! T: arctan: (x->arctan(x))
! R: sqrt (x->sqrt(x))
!
! nonary:
! 0
! 1
! P = pi
! a, b, c, ...: input variables for function (need not be listed in functions.dat)
program symbolic_regress
call go
end
subroutine go
implicit none
character*60 opsfile, templatefile, mysteryfile, outfile, usedfuncs
character*60 comline, functions, ops, formula
integer arities(21), nvar, nvarmax, nmax, lnblnk
parameter(nvarmax=20, nmax=5000000)
real*8 f, newloss, minloss, maxloss, rmsloss, limit
real*8 xy0(nvarmax+1,nmax), xy(nvarmax+1,nmax), y(nmax), offset(nmax), offst, bestoffset
real*8 epsilon, DL, nu, z
real*8 lossbits, bitmean, bitsdev, bestbits, bitmargin, sigma, bitexcess, ev
real*8 ymin, ymax
parameter(epsilon=1/2.**30)
data arities /2,2,2,2,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0/
data functions /"+*-/><~\OJLESCANTR01P"/
integer nn(0:2), ii(nmax), kk(nmax), radix(nmax), iarr(nmax)
integer ndata, i, i1, j, jtest, n
integer*8 nformulas, nevals
logical done, rejected
character*60 func(0:2), template
nu = 5.
bitmargin = 0. ! "Thickness" of pareto frontier; default 0
open(2,file='args.dat',status='old',err=666)
read(2,*) opsfile, templatefile, mysteryfile, outfile, nu, bitmargin
write(*,'(1a24,f10.3)') 'Rejection threshold.....',nu
write(*,'(1a24,f10.3)') 'Bit margin..............',bitmargin
comline = 'head -1 '//mysteryfile(1:lnblnk(mysteryfile))//' | wc > qaz.dat'
if (system(comline).ne.0) stop 'DEATH ERROR counting columns'
open(2,file='qaz.dat')
read(2,*) i, nvar
close(2)
nvar = nvar - 1
if (nvar.gt.nvarmax) stop 'DEATH ERROR: TOO MANY VARIABLES'
write(*,'(1a24,i8)') 'Number of variables.....',nvar
open(2,file=opsfile,status='old',err=668)
read(2,*) usedfuncs
close(2)
nn(0)=0
nn(1)=0
nn(2)=0
do i=1,lnblnk(usedfuncs)
if (usedfuncs(i:i).eq.'D') usedfuncs(i:i)='/'
if (usedfuncs(i:i).eq.'I') usedfuncs(i:i)='\'
j = index(functions,usedfuncs(i:i))
if (j.eq.0) then
print *,'DEATH ERROR: Unknown function requested: ',usedfuncs(i:i)
stop
else
nn(arities(j)) = nn(arities(j)) + 1
func(arities(j))(nn(arities(j)):nn(arities(j))) = functions(j:j)
end if
end do
! Add nonary ops to retrieve each of the input variables:
do i=1,nvar
nn(0) = nn(0) + 1
func(0)(nn(0):nn(0)) = char(96+i)
end do
write(*,'(1a24,1a22)') 'Functions used..........',usedfuncs(1:lnblnk(usedfuncs))
do i=0,2
write(*,*) 'Arity ',i,': ',func(i)(1:nn(i))
end do
write(*,'(1a24)') 'Loading mystery data....'
call LoadMatrixTranspose(nvarmax+1,nvar+1,nmax,ndata,xy0,mysteryfile)
write(*,'(1a24,i8)') 'Number of examples......',ndata
write(*,'(1a24)') 'Removing problematically small data points....'
ymax = 0.
do i=1,ndata
if (ymax.lt.abs(xy0(nvar+1,i))) ymax=abs(xy0(nvar+1,i))
end do
ymin = 0.001*ymax ! Require all data to exceed this
i1 = 0
print *,ymax,ymin
do i=1,ndata
if (abs(xy0(nvar+1,i)).gt.ymin) then ! Keep this data point
i1 = i1 + 1
do j=1,nvar+1
xy0(j,i1) = xy0(j,i1)
end do
end if
end do
write(*,*) ndata-i1," out of ",ndata," data points discarded for being too close to zero"
ndata = i1
write(*,'(1a24)') 'Shuffling mystery data....'
call permutation(ndata,iarr)
do i=1,ndata
do j=1,nvar+1
xy(j,i) = xy0(j,iarr(i))
end do
y(i) = xy(nvar+1,i)
end do
print *,'Searching for best fit...'
nformulas = 0
nevals = 0
bestbits = 1.e6
sigma = 1.d40 ! So that 1st function gets accepted
template = ''
ops='===================='
open(2,file=templatefile,status='old',err=670)
open(3,file=outfile)
555 read(2,'(1a60)',end=665) template
n = lnblnk(template)
!print *,"template:",template(1:n),"#####"
do i=1,n
ii(i) = ichar(template(i:i))-48
radix(i) = nn(ii(i))
kk(i) = 0
end do
done = .false.
do while ((bestbits.gt.0).and.(.not.done))
nformulas = nformulas + 1
! Analyze structure ii:
do i=1,n
ops(i:i) = func(ii(i))(1+kk(i):1+kk(i))
end do
j = 1
jtest = 2 ! Will test after j=2, 3, 5, 9, 17, ... data points
rejected = .false.
do while ((.not.rejected).and.(j.le.ndata)) ! Keep going as long as you can't reject this formula
nevals = nevals + 1
offst = y(j)/f(n,ii,ops,xy(1,j))
rejected = (.not.((offst.ge.0).or.(offst.le.0))) ! This was a NaN, so reject the formula :-)
!if (rejected) print *,"NaN!"
if (rejected) exit
rejected = (abs(offst).lt.epsilon).or.(abs(offst).gt.1./epsilon) ! Otherwise numerical cancellation can masquerade as success
!rejected = abs(log(abs(offst))).gt.(1./epsilon) ! Otherwise numerical cancellation can masquerade as successss
!if (rejected) print *,"Infinity!"
if (rejected) exit
offset(j) = offst
if (j.ge.jtest) then ! Time for another test
call analyze_offset(j,y,offset,epsilon,bestoffset,bitmean,bitsdev)
bitexcess = bitmean - bestbits - bitmargin
z = sqrt(1.*j)*bitexcess/sigma ! This sigma is for previous winner, not for this candidate
rejected = (z.gt.nu)
jtest = min(2*jtest-1,ndata)
end if
j = j + 1
end do
if (.not.rejected.and.(bitexcess.lt.0.)) then ! We have a new point on the Pareto frontier
bestbits = min(bitmean,bestbits)
rmsloss = 0.
maxloss = 0.
sigma = 0.
do j=1,ndata
newloss = abs(y(j) - f(n,ii,ops,xy(1,j))*bestoffset)
rmsloss = rmsloss + newloss**2
if (maxloss.lt.newloss) maxloss = newloss
end do
rmsloss = sqrt(rmsloss/ndata)
sigma = bitsdev
DL = log(1.*nformulas)/log(2.)
ev = (1.*nevals)/nformulas
write(*,'(2f20.12,x,1a22,1i16,6f19.4)') bitmean, limit(bestoffset), ops(1:n), nformulas, DL, DL+ndata*bitmean, rmsloss, maxloss, bitsdev, ev
write(3,'(2f20.12,x,1a22,1i16,6f19.4)') bitmean, limit(bestoffset), ops(1:n), nformulas, DL, DL+ndata*bitmean, rmsloss, maxloss, bitsdev, ev
flush(3)
end if
call multiloop(n,radix,kk,done)
end do
goto 555
665 close(3)
close(2)
print *,'All done: results in ',outfile
return
666 stop 'DEATH ERROR: missing file args.dat'
668 print *,'DEATH ERROR: missing file ',opsfile(1:lnblnk(opsfile))
stop
670 print *,'DEATH ERROR: missing file ',templatefile(1:lnblnk(templatefile))
stop
end
subroutine analyze_offset(n,y,offset,epsilon,median,bitmean,bitsdev) ! Check how much an array departs from its median
implicit none
integer n, i
real*8 y(n), offset(n), epsilon, bitmean, bitsdev
real*8 median, mymedian, x, f, bits, sum1, sum2
median = mymedian(n,offset)
sum1 = 0.
sum2 = 0.
do i=1,n
f = y(i)/offset(i)
x = abs(y(i)-median*f)/epsilon
if (x.gt.1) then
bits = 1.44269504089*log(x) ! = log2(x)
else
bits = 0.
end if
sum1 = sum1 + bits
sum2 = sum2 + bits*bits
!print *,i,y(i),offset(i),abs(y(i)*(offset(i)-median)),x
!read *
end do
bitmean = sum1/n
bitsdev = sqrt(abs(sum2/n-bitmean**2))
return
end
include "tools.f"